CAS 759448-14-1

(R)-3-Amino-4-(4-nitrophenyl)butyric acid

Description:

(R)-3-Amino-4-(4-nitrophenyl)butyric acid, identified by its CAS number 759448-14-1, is an amino acid derivative characterized by the presence of an amino group and a nitrophenyl substituent. This compound features a chiral center, which contributes to its (R) configuration, influencing its biological activity and interactions. The nitrophenyl group enhances its potential as a pharmacophore, making it of interest in medicinal chemistry for applications such as drug development. The presence of both the amino and carboxylic acid functional groups allows it to participate in various chemical reactions, including peptide bond formation. Its solubility is typically influenced by the pH of the environment, as the amino group can be protonated, while the carboxylic acid can donate a proton. This compound may exhibit specific biological activities, potentially acting as an inhibitor or modulator in biochemical pathways. Overall, (R)-3-Amino-4-(4-nitrophenyl)butyric acid is a versatile compound with significant implications in research and pharmaceutical applications.

Formula: C₁₀H₁₂N₂O₄

InChI: InChI=1/C10H12N2O4/c11-8(6-10(13)14)5-7-1-3-9(4-2-7)12(15)16/h1-4,8H,5-6,11H2,(H,13,14)/t8-/m1/s1

SMILES: c1cc(ccc1C[C@H](CC(=O)O)N)N(=O)=O

Synonyms:

• (3R)-3-Amino-4-(4-nitrophenyl)butanoic acid
• benzenebutanoic acid, beta-amino-4-nitro-, (betaR)-