CAS 759452-96-5

Spiro[furo[3,4-c]pyridine-3(1H),4'-piperidin]-1-one

Description:

Spiro[furo[3,4-c]pyridine-3(1H),4'-piperidin]-1-one is a heterocyclic compound characterized by its unique spirocyclic structure, which incorporates both a furo[3,4-c]pyridine moiety and a piperidinone unit. This compound typically exhibits a fused ring system, contributing to its potential biological activity and chemical stability. The presence of nitrogen atoms in the pyridine and piperidine rings can influence its reactivity and solubility, making it of interest in medicinal chemistry. Additionally, the compound may display various pharmacological properties, including potential anti-inflammatory or antimicrobial activities, although specific biological data would depend on empirical studies. Its structural complexity allows for diverse interactions with biological targets, which is a key consideration in drug design. As with many heterocycles, the electronic properties and steric factors of the substituents can significantly affect its chemical behavior and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1/C11H12N2O2/c14-10-8-1-4-13-7-9(8)11(15-10)2-5-12-6-3-11/h1,4,7,12H,2-3,5-6H2

SMILES: c1cncc2c1C(=O)OC12CCNCC1

Synonyms:

• Spiro[furo[3,4-c]pyridine-3,4'-piperidin]-1-one
• 1H-Spiro[furo[3,4-c]pyridine-3,4'-piperidine]-1-one
• 1H-spiro[furo[3,4-c]pyridine-3,4'-piperidin]-1-one