CAS 759456-60-5
:(5-amino-2-morpholino-phenyl)methanol
Description:
(5-amino-2-morpholino-phenyl)methanol is an organic compound characterized by its specific functional groups and structural features. It contains an amino group (-NH2), a morpholine ring, and a phenolic hydroxyl group (-OH) attached to a methanol moiety. The presence of the amino group suggests potential basicity and reactivity in various chemical reactions, while the morpholine ring contributes to its cyclic structure and may influence its solubility and biological activity. The phenolic hydroxyl group can participate in hydrogen bonding, enhancing its interactions with other molecules. This compound may exhibit properties such as moderate polarity, making it soluble in polar solvents. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may act as a building block or a lead compound due to its ability to interact with biological targets. Additionally, the compound's stability and reactivity can be influenced by the surrounding functional groups, making it a subject of interest in synthetic organic chemistry and drug design.
Formula:C11H16N2O2
InChI:InChI=1/C11H16N2O2/c12-10-1-2-11(9(7-10)8-14)13-3-5-15-6-4-13/h1-2,7,14H,3-6,8,12H2
SMILES:c1cc(c(cc1N)CO)N1CCOCC1
Synonyms:- [5-Amino-2-(morpholin-4-yl)phenyl]methanol
- Benzenemethanol, 5-amino-2-(4-morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(5-Amino-2-morpholinophenyl)methanol
CAS:Formula:C11H16N2O2Color and Shape:SolidMolecular weight:208.2569
