
CAS 75946-94-0
:(6aR)-6-(2-Chloroethyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol
Description:
The chemical substance known as (6aR)-6-(2-Chloroethyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol, with the CAS number 75946-94-0, is a complex organic compound characterized by its unique bicyclic structure, which includes a dibenzoquinoline framework. This compound features a chloroethyl substituent, contributing to its reactivity and potential biological activity. The presence of hydroxyl groups at the 10 and 11 positions indicates that it may exhibit properties typical of phenolic compounds, such as antioxidant activity. The stereochemistry denoted by (6aR) suggests specific spatial arrangements of atoms, which can influence the compound's interactions in biological systems. Its tetrahydro configuration implies that it is partially saturated, affecting its stability and solubility. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents, due to its structural complexity and potential biological effects. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C18H18ClNO2
InChI:InChI=1S/C18H18ClNO2/c19-7-9-20-8-6-11-2-1-3-13-16(11)14(20)10-12-4-5-15(21)18(22)17(12)13/h1-5,14,21-22H,6-10H2/t14-/m1/s1
InChI key:InChIKey=RMKWDBUEXHJPRZ-CQSZACIVSA-N
SMILES:C(CCl)N1[C@]2(C=3C(C=4C(C2)=CC=C(O)C4O)=CC=CC3CC1)[H]
Synonyms:- 4H-Dibenzo[de,g]quinoline-10,11-diol, 6-(2-chloroethyl)-5,6,6a,7-tetrahydro-, (R)-
- (6aR)-6-(2-Chloroethyl)-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-10,11-diol
- N-Chloroethylnorapomorphine
- (-)-N-(Chloroethyl)norapomorphine
- 4H-Dibenzo[de,g]quinoline-10,11-diol, 6-(2-chloroethyl)-5,6,6a,7-tetrahydro-, (6aR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(-)-N-(2-Chloroethyl)norapomorphine
CAS:Controlled ProductFormula:C18H18ClNO2Color and Shape:NeatMolecular weight:315.794
