CAS 7595-91-7
:dimethyl tetrahydro[1,3]dioxino[5,4-d][1,3]dioxine-4,8-dicarboxylate (non-preferred name)
Description:
Dimethyl tetrahydro[1,3]dioxino[5,4-d][1,3]dioxine-4,8-dicarboxylate, identified by CAS number 7595-91-7, is a chemical compound characterized by its complex bicyclic structure that incorporates dioxin and dioxole functionalities. This compound typically exhibits a high degree of stability due to its saturated ring system, which can influence its reactivity and interactions with other chemical species. It is a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of carboxylate groups suggests potential for hydrogen bonding and reactivity in various chemical environments, making it useful in organic synthesis and potentially in medicinal chemistry. Its dimethyl ester form indicates that it can undergo hydrolysis to yield corresponding acids, which may have different biological activities. Safety data should be consulted, as compounds with dioxin-like structures can sometimes exhibit toxicity or environmental persistence. Overall, this compound's unique structure and functional groups make it of interest in various chemical applications.
Formula:C10H14O8
InChI:InChI=1/C10H14O8/c1-13-9(11)7-5-6(16-3-17-7)8(10(12)14-2)18-4-15-5/h5-8H,3-4H2,1-2H3
SMILES:COC(=O)C1C2C(C(C(=O)OC)OCO2)OCO1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,4:3,5-Di-O-methylene-D-idaric Acid
CAS:Controlled ProductFormula:C8H10O8Color and Shape:NeatMolecular weight:234.16
