CAS 7596-36-3

1-[2-(4-methoxyphenyl)-2-oxoethyl]pyridinium

Description:

1-[2-(4-Methoxyphenyl)-2-oxoethyl]pyridinium, with the CAS number 7596-36-3, is a chemical compound characterized by its pyridinium structure, which includes a positively charged nitrogen atom within a six-membered aromatic ring. This compound features a 4-methoxyphenyl group, contributing to its aromatic properties and potential for various interactions. The presence of the 2-oxoethyl moiety indicates that it has a carbonyl group adjacent to an ethyl group, which can participate in nucleophilic reactions. The methoxy group enhances the compound's solubility in organic solvents and may influence its reactivity and biological activity. Typically, such compounds can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the pyridinium ion can engage in ionic interactions, which may affect its behavior in biological systems. Overall, this compound's unique structural features suggest potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₄H₁₄NO₂

InChI: InChI=1/C14H14NO2/c1-17-13-7-5-12(6-8-13)14(16)11-15-9-3-2-4-10-15/h2-10H,11H2,1H3/q+1

Synonyms:

• Pyridinium, 1-[2-(4-methoxyphenyl)-2-oxoethyl]-
• 1-[2-(4-Methoxyphenyl)-2-oxoethyl]pyridinium