CAS 75969-83-4

11-Hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one

Description:

11-Hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one, with the CAS number 75969-83-4, is a heterocyclic compound characterized by its complex fused ring structure, which includes an indole and naphthyridine moiety. This compound typically exhibits properties associated with its aromatic nature, such as stability and potential for π-π stacking interactions. The presence of a hydroxyl group at the 11-position contributes to its solubility in polar solvents and may influence its reactivity and biological activity. Compounds of this type are often studied for their potential pharmacological properties, including antimicrobial and anticancer activities, due to their ability to interact with biological targets such as enzymes and receptors. Additionally, the unique structural features of 11-hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one may allow for the development of derivatives with enhanced efficacy or selectivity in therapeutic applications. Overall, this compound represents a fascinating area of study within medicinal chemistry and drug design.

Formula: C₁₄H₈N₂O₂

InChI: InChI=1S/C14H8N2O2/c17-11-3-1-2-10-13(11)8-6-7-15-9-4-5-12(18)16(10)14(8)9/h1-7,17H

InChI key: InChIKey=KXFAUPPCQVBDBN-UHFFFAOYSA-N

SMILES: O=C1N2C=3C(C=4C2=CC=CC4O)=CC=NC3C=C1

Synonyms:

• 6H-Indolo[3,2,1-de][1,5]naphthyridin-6-one, 11-hydroxy-
• 11-Hydroxy-6H-indolo[3,2,1-de][1,5]naphthyridin-6-one
• 11-Hydroxycanthin-6-one
• Amarorine
• NSC 356209

11-Hydroxycanthin-6-one

CAS: 75969-83-4

11-Hydroxy-canthin-6-one has antineoplastic activity.

Formula: C₁₄H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 236.23

Ref: TM-TN2583

11-Hydroxycanthin-6-one

CAS: 75969-83-4

Formula: C₁₄H₈N₂O₂

Purity: 95%~99%

Molecular weight: 236.23

Ref: BP-BPF2125

11-Hydroxycanthin-6-one

CAS: 75969-83-4

11-Hydroxycanthin-6-one is a naturally occurring bioactive compound classified as an indole alkaloid. It is primarily derived from specific plant species belonging to the Rutaceae family. This compound functions by interacting with various biological pathways, potentially modulating enzyme activity and receptor interactions, which are yet to be fully elucidated in scientific literature.

Formula: C₁₄H₈N₂O₂

Purity: Min. 95%

Molecular weight: 236.22 g/mol

Ref: 3D-ADA96983