CAS 7597-14-0
:N-(7-chloroquinolin-4-yl)propane-1,3-diamine
Description:
N-(7-chloroquinolin-4-yl)propane-1,3-diamine, with the CAS number 7597-14-0, is a chemical compound characterized by its structure, which includes a quinoline moiety substituted with a chlorine atom and a propane chain featuring two amine groups. This compound typically exhibits properties associated with both aromatic and aliphatic amines, such as potential basicity due to the presence of the amine groups. The chlorine substituent on the quinoline ring can influence its reactivity and biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display moderate solubility in polar solvents, depending on the pH and the presence of functional groups. Its unique structure allows for interactions with biological targets, which can be explored for therapeutic applications. As with many amines, it may participate in hydrogen bonding and can act as a ligand in coordination chemistry. Safety and handling considerations should be taken into account due to the potential toxicity associated with amines and halogenated compounds.
Formula:C12H14ClN3
InChI:InChI=1/C12H14ClN3/c13-9-2-3-10-11(15-6-1-5-14)4-7-16-12(10)8-9/h2-4,7-8H,1,5-6,14H2,(H,15,16)
SMILES:C(CN)CNc1ccnc2cc(ccc12)Cl
Synonyms:- 1,3-propanediamine, N~1~-(7-chloro-4-quinolinyl)-
- Tcmdc-123921
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.