CAS 7597-47-9

methyl 3-[(4-nitrophenyl)sulfanyl]propanoate

Description:

Methyl 3-[(4-nitrophenyl)sulfanyl]propanoate, with the CAS number 7597-47-9, is an organic compound characterized by its ester functional group and the presence of a nitrophenyl sulfanyl moiety. This compound features a methyl ester derived from propanoic acid, where the propanoate group is substituted with a 4-nitrophenyl sulfanyl group. The nitro group (-NO2) on the phenyl ring contributes to the compound's electron-withdrawing properties, which can influence its reactivity and interactions in chemical reactions. The sulfanyl group (-S-) introduces potential for nucleophilic substitution reactions, making it a versatile intermediate in organic synthesis. Methyl 3-[(4-nitrophenyl)sulfanyl]propanoate may exhibit moderate solubility in organic solvents and is likely to be stable under standard conditions, although it may be sensitive to strong acids or bases. Its unique structure allows for applications in pharmaceuticals, agrochemicals, and materials science, where it can serve as a building block for more complex molecules.

Formula: C₁₀H₁₁NO₄S

InChI: InChI=1/C10H11NO4S/c1-15-10(12)6-7-16-9-4-2-8(3-5-9)11(13)14/h2-5H,6-7H2,1H3

SMILES: COC(=O)CCSc1ccc(cc1)N(=O)=O

Methyl 3-(4-nitrophenyl)sulfanylpropanoate

CAS: 7597-47-9

Methyl 3-(4-nitrophenyl)sulfanylpropanoate

Purity: ≥95%

Molecular weight: 241.26g/mol

Ref: 54-OR111556