CAS 7597-60-6: N-(6-Amino-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)formamide
Description:N-(6-Amino-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)formamide, with CAS number 7597-60-6, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with an amino group and a formamide moiety, contributing to its potential biological activity. It is characterized by its tetrahydro structure, which indicates the presence of a saturated cyclic component, and the presence of two carbonyl groups (dioxo) that can participate in various chemical reactions. The dimethyl groups suggest that the compound may exhibit specific steric and electronic properties, influencing its reactivity and interactions with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for the development of pharmaceuticals or agrochemicals. However, detailed studies on its solubility, stability, and biological activity would be necessary to fully understand its potential applications and safety profile.
Formula:C7H10N4O3
InChI:InChI=1S/C7H10N4O3/c1-10-5(8)4(9-3-12)6(13)11(2)7(10)14/h3H,8H2,1-2H3,(H,9,12)
InChI key:InChIKey=ZNDGAXCBZGSJGU-UHFFFAOYSA-N
SMILES:O=CNC=1C(=O)N(C(=O)N(C1N)C)C
- Synonyms:
- 1,3-Dimethyl-4-amino-5-(formylamino)uracil
- 6-Amino-1,3-dimethyl-5-(formylamino)pyrimidine-2,4-dione
- Formamide, N-(6-amino-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)-
- N-(6-Amino-1,2,3,4-tetrahydro-1,3-dimethyl-2,4-dioxo-5-pyrimidinyl)formamide
- N-(6-amino-1,3-dimethyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)formamide
- NSC 42307
- Uracil, 6-amino-5-formamido-1,3-dimethyl-
- 6-Amino-5-formamido-1,3-dimethyluracil
