CAS 7598-35-8

4-Pyridinamine, 2-bromo-

Description:

4-Pyridinamine, 2-bromo- is an organic compound characterized by a pyridine ring substituted with an amino group and a bromine atom. Its molecular structure features a six-membered aromatic ring containing one nitrogen atom, which contributes to its basicity and potential reactivity. The presence of the amino group (-NH2) makes it a primary amine, allowing for hydrogen bonding and increasing its solubility in polar solvents. The bromine substituent at the 2-position introduces electrophilic characteristics, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is often utilized in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds due to its functional groups that can participate in further chemical transformations. Additionally, 4-Pyridinamine, 2-bromo- may exhibit biological activity, making it of interest in medicinal chemistry. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₅H₅BrN₂

InChI: InChI=1/C5H5BrN2/c6-5-3-4(7)1-2-8-5/h1-3H,(H2,7,8)

SMILES: c1cnc(cc1N)Br

Synonyms:

• 4-Amino-2-bromopyridine
• 2-Bromo-4-aminopyridine
• 2-Bromo-4-pyridinamine
• 2-Bromopyridin-4-Amine
• 2-Bromo-pyridin-4-ylamine

2-Bromopyridin-4-amine

CAS: 7598-35-8

Formula: C₅H₅BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 173.0106

Ref: IN-DA008OX0

4-Amino-2-bromopyridine

CAS: 7598-35-8

Formula: C₅H₅BrN₂

Molecular weight: 173.01

Ref: 7W-GK8884

4-Amino-2-bromopyridine

CAS: 7598-35-8

4-Amino-2-bromopyridine

Formula: C₅H₅BrN₂

Purity: ≥95%

Color and Shape: beige to light brown to brown crystalline solid

Molecular weight: 173.01g/mol

Ref: 54-OR13064

4-Amino-2-bromopyridine

CAS: 7598-35-8

Formula: C₅H₅BrN₂

Purity: 98%

Color and Shape: Chunks,Crystalline Powder

Molecular weight: 173.013

Ref: 10-F043852