CAS 7598-84-7

Z-Gly-Gly-Gly-Gly-Gly-Gly-OH

Description:

The chemical substance known as Z-Gly-Gly-Gly-Gly-Gly-Gly-OH, with the CAS number 7598-84-7, is a synthetic peptide composed of six glycine residues (Gly) with a Z (benzyloxycarbonyl) protecting group at the amino terminus. This structure indicates that it is a derivative of glycine, the simplest amino acid, which is non-polar and plays a crucial role in protein synthesis. The Z group serves to protect the amino group during peptide synthesis, allowing for the selective formation of peptide bonds. Z-Gly-Gly-Gly-Gly-Gly-Gly-OH is often used in biochemical research and applications, including studies on peptide synthesis, protein folding, and as a building block in the development of more complex peptides. Its properties include high solubility in water and a relatively low molecular weight, making it suitable for various laboratory applications. Additionally, due to the presence of multiple glycine units, it may exhibit unique conformational characteristics that can influence its biological activity and interactions with other molecules.

Formula: C₂₀H₂₆N₆O₉

InChI: InChI=1/C20H26N6O9/c27-14(21-7-15(28)23-9-17(30)25-11-19(32)33)6-22-16(29)8-24-18(31)10-26-20(34)35-12-13-4-2-1-3-5-13/h1-5H,6-12H2,(H,21,27)(H,22,29)(H,23,28)(H,24,31)(H,25,30)(H,26,34)(H,32,33)

SMILES: c1ccc(cc1)COC(=NCC(=NCC(=NCC(=NCC(=NCC(=NCC(=O)O)O)O)O)O)O)O

Synonyms:

• N-[(benzyloxy)carbonyl]glycylglycylglycylglycylglycylglycine

Z-Gly-Gly-Gly-Gly-Gly-Gly-OH

CAS: 7598-84-7

Please enquire for more information about Z-Gly-Gly-Gly-Gly-Gly-Gly-OH including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₀H₂₆N₆O₉

Purity: Min. 95%

Molecular weight: 494.46 g/mol

Ref: 3D-FG111468