
CAS 75983-36-7
:4,8-Dimethyldecanal
Description:
4,8-Dimethyldecanal is an organic compound classified as an aldehyde, characterized by its long carbon chain and the presence of two methyl groups at the 4th and 8th positions of the decanal structure. This compound features a straight-chain structure with a total of ten carbon atoms, making it part of the aliphatic aldehyde family. Its molecular formula is C12H24O, indicating the presence of a carbonyl group (C=O) at one end of the chain, which is typical for aldehydes. 4,8-Dimethyldecanal is likely to exhibit a distinctive odor, often associated with fatty or waxy scents, which can be utilized in flavor and fragrance applications. The compound's physical properties, such as boiling point and solubility, are influenced by its molecular structure, with larger aldehydes generally being less soluble in water but more soluble in organic solvents. Additionally, due to its structure, it may participate in various chemical reactions typical of aldehydes, including oxidation and condensation reactions. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C12H24O
InChI:InChI=1S/C12H24O/c1-4-11(2)7-5-8-12(3)9-6-10-13/h10-12H,4-9H2,1-3H3
InChI key:InChIKey=XAUQKOJHYTYNRM-UHFFFAOYSA-N
SMILES:C(C(CCC=O)C)CCC(CC)C
Synonyms:- Tribolon
- Decanal, 4,8-dimethyl-
- 4,8-Dimethyl-1-decanal
- 4,8-Dimethyldecanal
- Tribolure
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.