CAS 75985-52-3
:(2R)-1-[(1R)-1-phenylethyl]aziridine-2-carboxamide
Description:
(2R)-1-[(1R)-1-phenylethyl]aziridine-2-carboxamide is a chiral aziridine derivative characterized by its three-membered ring structure, which includes a nitrogen atom. This compound features a carboxamide functional group, contributing to its potential reactivity and solubility in polar solvents. The presence of the phenylethyl group enhances its steric and electronic properties, making it of interest in asymmetric synthesis and medicinal chemistry. The specific stereochemistry indicated by the (2R) and (1R) designations suggests that the compound exhibits chirality, which can influence its biological activity and interactions with other molecules. Aziridines are known for their strain due to the small ring size, which can lead to increased reactivity, particularly in nucleophilic substitution reactions. This compound may serve as a building block in the synthesis of more complex molecules or as a potential pharmacophore in drug development. Its unique structural features and chirality make it a valuable subject of study in organic and medicinal chemistry.
Formula:C11H14N2O
InChI:InChI=1/C11H14N2O/c1-8(9-5-3-2-4-6-9)13-7-10(13)11(12)14/h2-6,8,10H,7H2,1H3,(H2,12,14)/t8-,10-,13?/m1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(R)-1-[(1R)-α-Methylbenzyl]aziridine-2-carboxamide
CAS:Formula:C11H14N2OColor and Shape:SolidMolecular weight:190.2417

