CAS 75989-19-4
:3-(3-oxo-2,3-dihydroisoxazol-5-yl)propanoic acid
Description:
3-(3-oxo-2,3-dihydroisoxazol-5-yl)propanoic acid, with the CAS number 75989-19-4, is a chemical compound characterized by its unique isoxazole ring structure, which contributes to its reactivity and potential biological activity. This compound features a propanoic acid moiety, indicating the presence of a carboxylic acid functional group, which is known for its acidic properties and ability to participate in various chemical reactions, such as esterification and amidation. The isoxazole ring, a five-membered heterocyclic compound containing both nitrogen and oxygen, often imparts specific pharmacological properties, making such compounds of interest in medicinal chemistry. The presence of the keto group (3-oxo) enhances the compound's reactivity, potentially allowing for further derivatization. Overall, this compound's structural features suggest it may exhibit interesting chemical behavior and biological activity, warranting further investigation for applications in pharmaceuticals or agrochemicals.
Formula:C6H7NO4
InChI:InChI=1/C6H7NO4/c8-5-3-4(11-7-5)1-2-6(9)10/h3H,1-2H2,(H,7,8)(H,9,10)
SMILES:C(CC(=O)O)c1cc(no1)O
Synonyms:- 5-Isoxazolepropanoic Acid, 2,3-Dihydro-3-Oxo-
- 5-Isoxazolepropanoic Acid, 3-Hydroxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(3-Hydroxyisoxazol-5-yl)propanoic acid
CAS:<p>3-(3-Hydroxyisoxazol-5-yl)propanoic acid is a fine chemical used as a reagent, speciality chemical, and reaction component in the synthesis of complex compounds. It is also used as a building block or scaffold in the synthesis of other compounds. 3-(3-Hydroxyisoxazol-5-yl)propanoic acid is less reactive than other carboxylic acids due to its bulky group at one end. This makes it more stable and easier to handle. 3-(3-Hydroxyisoxazol-5-yl)propanoic acid can be used for research purposes and has been shown to be an effective inhibitor of HIV protease.</p>Formula:C6H7NO4Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:157.12 g/mol
