CAS 75989-22-9

4-(Chloromethyl)-3-methoxy-5-methylisoxazole

Description:

4-(Chloromethyl)-3-methoxy-5-methylisoxazole, with the CAS number 75989-22-9, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a chloromethyl group, a methoxy group, and a methyl group attached to the isoxazole ring, contributing to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the chloromethyl group makes it a useful intermediate for further chemical modifications, while the methoxy and methyl substituents can influence its solubility and biological activity. Typically, compounds like this may exhibit various biological activities, making them of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental concerns.

Formula: C₆H₈ClNO₂

InChI: InChI=1S/C6H8ClNO2/c1-4-5(3-7)6(9-2)8-10-4/h3H2,1-2H3

InChI key: InChIKey=AIAXEKOVIPQUEY-UHFFFAOYSA-N

SMILES: C(Cl)C=1C(OC)=NOC1C

Synonyms:

• 4-(Chloromethyl)-3-methoxy-5-methylisoxazole
• Isoxazole, 4-(chloromethyl)-3-methoxy-5-methyl-

4-(Chloromethyl)-3-methoxy-5-methyl-1,2-oxazole

CAS: 75989-22-9

4-(Chloromethyl)-3-methoxy-5-methyl-1,2-oxazole (CGS 19755) is a neuroprotective agent that binds to the glutamate receptor, inhibiting glutamate binding. It also inhibits the production of intracellular cGMP, which may be due to its ability to inhibit the binding of G protein coupled receptors. CGS 19755 has been shown to have neuroprotective properties in vivo and expressed in vitro. It has high affinity for both alpha-amino-3-hydroxy-5-methylisoxazolepropionic acid (AMPA) and N -methyl--aspartic acid (NMDA) receptors.
CGS 19755 has been shown to be more potent than other glutamate antagonists such as LY 273558 in animal tests for neuroprotection.

Formula: C₆H₈ClNO₂

Purity: Min. 95%

Molecular weight: 161.58 g/mol

Ref: 3D-ADA98922