CAS 75998-29-7
:3-Chloro-6-methoxybenzo[b]thiophene-2-carbonyl chloride
Description:
3-Chloro-6-methoxybenzo[b]thiophene-2-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a benzo[b]thiophene core substituted with a chlorine atom and a methoxy group. This compound features a carbonyl chloride functional group, making it a reactive acyl chloride. The presence of the chlorine atom contributes to its electrophilic nature, while the methoxy group can influence its solubility and reactivity. Typically, compounds of this type are utilized in organic synthesis, particularly in the preparation of various derivatives through nucleophilic substitution reactions. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications can lead to biologically active molecules. Its reactivity as an acyl chloride allows for the introduction of various nucleophiles, making it a versatile intermediate in synthetic chemistry. Safety precautions should be observed when handling this compound due to its reactive nature and potential hazards associated with chlorine and acyl chlorides.
Formula:C10H6Cl2O2S
InChI:InChI=1/C10H6Cl2O2S/c1-14-5-2-3-6-7(4-5)15-9(8(6)11)10(12)13/h2-4H,1H3
SMILES:COc1ccc2c(c1)sc(c2Cl)C(=O)Cl
Synonyms:- 3-Chloro-6-methoxy-1-benzothiophene-2-carbonyl chloride
- Benzo[B]Thiophene-2-Carbonyl Chloride, 3-Chloro-6-Methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Chloro-6-methoxy-1-benzothiophene-2-carbonyl chloride
CAS:Formula:C10H6Cl2O2SMolecular weight:261.1244
