CAS 75998-99-1

4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenol

Description:

4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]phenol, with the CAS number 75998-99-1, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The compound features a pyrazole moiety, specifically a 3,5-dimethyl-1H-pyrazole, linked through a methylene (-CH2-) bridge to the phenolic ring. This structure imparts unique chemical properties, including potential antioxidant activity and the ability to participate in various chemical reactions due to the presence of both the phenolic and pyrazole functionalities. The compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Additionally, the presence of methyl groups on the pyrazole ring can influence its electronic properties and steric hindrance, affecting its interactions with other molecules. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry and biology.

Formula: C₁₂H₁₄N₂O

InChI: InChI=1/C12H14N2O/c1-8-12(9(2)14-13-8)7-10-3-5-11(15)6-4-10/h3-6,15H,7H2,1-2H3,(H,13,14)

SMILES: Cc1c(Cc2ccc(cc2)O)c(C)n[nH]1

Synonyms:

• phenol, 4-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-