CAS 76-20-0
:2,2-Bis(ethylsulfonyl)butane
Description:
2,2-Bis(ethylsulfonyl)butane, with the CAS number 76-20-0, is an organic compound characterized by its sulfonyl functional groups attached to a butane backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its relatively high stability and low volatility, making it suitable for various applications in organic synthesis and as a reagent in chemical reactions. The presence of ethylsulfonyl groups imparts unique reactivity, allowing it to participate in nucleophilic substitution reactions and serve as a sulfonylating agent. Additionally, it is soluble in polar organic solvents, which enhances its utility in diverse chemical environments. Safety considerations include handling it with care, as it may pose health risks upon exposure. Overall, 2,2-Bis(ethylsulfonyl)butane is a valuable compound in synthetic organic chemistry, contributing to the development of more complex molecules.
Formula:C8H18O4S2
InChI:InChI=1S/C8H18O4S2/c1-5-8(4,13(9,10)6-2)14(11,12)7-3/h5-7H2,1-4H3
InChI key:InChIKey=LKACJLUUJRMGFK-UHFFFAOYSA-N
SMILES:C(S(CC)(=O)=O)(S(CC)(=O)=O)(CC)C
Synonyms:- 2,2-Bis(Ethylsulfonyl)Butane
- Butane, 2,2-bis(ethylsulfonyl)-
- Ethylsulfonal
- Ethylsulphonal
- Methylsulfonal
- Methylsulphonal
- NSC 3994
- Sulfonethylmethane
- Tional
- Trional
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
