CAS 76-30-2
:Dihydroxytartaric acid
Description:
Dihydroxytartaric acid, also known as racemic tartaric acid, is a naturally occurring organic compound with the molecular formula C4H6O6. It is a dihydroxy derivative of tartaric acid, featuring two hydroxyl (-OH) groups attached to its carbon backbone. This compound is typically found in various plants, particularly in grapes, and plays a significant role in the winemaking process. Dihydroxytartaric acid is a white crystalline solid that is soluble in water and exhibits a slightly acidic nature. It has two stereocenters, leading to the existence of multiple stereoisomers, including the meso form and enantiomers. The compound is utilized in various applications, including as a chiral auxiliary in asymmetric synthesis, in the food industry as a stabilizing agent for certain emulsions, and in pharmaceuticals. Its ability to form complexes with metal ions also makes it valuable in analytical chemistry. Overall, dihydroxytartaric acid is an important compound with diverse applications across multiple fields.
Formula:C4H6O8
InChI:InChI=1S/C4H6O8/c5-1(6)3(9,10)4(11,12)2(7)8/h9-12H,(H,5,6)(H,7,8)
InChI key:InChIKey=XHWHHMNORMIBBB-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)(O)O)(C(O)=O)(O)O
Synonyms:- 2,2,3,3-Tetrahydroxybutanedioic acid
- Butanedioic acid, 2,2,3,3-tetrahydroxy-
- Butanedioic acid, tetrahydroxy-
- Dihydroxytartaric Acid
- NSC 4647
- Succinic acid, tetrahydroxy-
- Tetrahydroxybutanedioic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: 4Z-T-899
Discontinued productRef: ST-EA-CP-T121006
Discontinued product

