CAS 76-77-7
:Neoquassin
Description:
Neoquassin, with the CAS number 76-77-7, is a chemical compound that belongs to the class of natural products known as quassinoids, which are derived from the Quassia tree. It is characterized by its complex tetracyclic structure, which contributes to its biological activity. Neoquassin exhibits a bitter taste and has been studied for its potential medicinal properties, including anti-cancer and anti-parasitic effects. It is known to interact with various biological pathways, making it of interest in pharmacological research. Additionally, neoquassin has been investigated for its potential use as a natural insecticide due to its toxicity to certain pests. Its solubility properties and stability under different conditions are important for its application in both research and potential therapeutic uses. As with many natural compounds, the extraction and purification processes can influence its availability and efficacy in various applications. Overall, neoquassin represents a fascinating area of study within natural product chemistry and its potential applications in medicine and agriculture.
Formula:C22H30O6
InChI:InChI=1S/C22H30O6/c1-10-7-14(26-5)20(25)22(4)12(10)8-15-21(3)13(9-16(23)28-15)11(2)18(27-6)17(24)19(21)22/h7,10,12-13,15-16,19,23H,8-9H2,1-6H3
InChI key:InChIKey=BDQNCUODBJZKIY-UHFFFAOYSA-N
SMILES:CC12C3C4(C)C(CC1OC(O)CC2C(C)=C(OC)C3=O)C(C)C=C(OC)C4=O
Synonyms:- 16-Hydroxy-2,12-Dimethoxypicrasa-2,12-Diene-1,11-Dione
- Neoquassine
- Nigakihemiacetal B
- Nsc 139168
- Phenanthro[10,1-bc]pyran, picrasa-2,12-diene-1,11-dione deriv.
- Phenanthro[10,1-bc]pyran-1,11-dione, 3a,4,5,6a,7,7a,8,11a,11b,11c-decahydro-5-hydroxy-2,10-dimethoxy-3,8,11a,11c-tetramethyl-
- Picrasa-2,12-diene-1,11-dione, 16-hydroxy-2,12-dimethoxy-
- Picrasa-2,12-diene-1,11-dione, 16-hydroxy-2,12-dimethoxy- (9CI)
- Simalikahemiacetal A
- Neoquassin
- Neoquassin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Picrasa-2,12-diene-1,11-dione,16-hydroxy-2,12-dimethoxy-
CAS:Formula:C22H30O6Purity:95%Molecular weight:390.4700Neoquassin
CAS:Quassin, neoquassin and picrasinoside B are insecticide quassinoids.Formula:C22H30O6Purity:98%Color and Shape:SolidMolecular weight:390.48Neoquassin
CAS:Oxygen-heterocyclic compoundFormula:C22H30O6Purity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:390.47Neoquassin
CAS:Neoquassin is a quassinoid derivative, which is a class of naturally occurring compounds. It is derived from the plants of the Simaroubaceae family, specifically sourced from Quassia amara or Quassia simarouba. These compounds are known for their complex structure and bioactive properties. Neoquassin acts primarily through the inhibition of protein synthesis, disrupting the ribosomal function in cells. This mode of action positions it as a compound of interest in the study of anticancer and antiparasitic activities due to its ability to affect rapidly dividing cells and organisms.
Formula:C22H30O6Purity:Min. 95%Molecular weight:390.47 g/mol








