CymitQuimica logo

CAS 760-58-7

:

2-cyano-4-methylpent-2-enoic acid

Description:
2-Cyano-4-methylpent-2-enoic acid, with the CAS number 760-58-7, is an organic compound characterized by its unique structure that includes a cyano group (-CN) and a carboxylic acid group (-COOH) attached to a pentene backbone. This compound is typically a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. It is known for its reactivity, particularly in organic synthesis, where it can participate in various chemical reactions such as nucleophilic additions and cycloadditions. The presence of both the cyano and carboxylic acid functional groups makes it a versatile intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, it exhibits polar characteristics due to the functional groups, which can influence its solubility in polar solvents. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled, and proper storage conditions should be maintained to ensure stability.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c1-5(2)3-6(4-8)7(9)10/h3,5H,1-2H3,(H,9,10)
InChI key:JYFREZOLRUHBAQ-ZZXKWVIFSA-N
SMILES:CC(C)C=C(C#N)C(=O)O
Found 6 products.