CAS 7600-50-2
:2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid
Description:
2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid, with the CAS number 7600-50-2, is an organic compound that belongs to the class of benzoic acids. It features a benzoic acid core substituted with two chlorine atoms at the 2 and 5 positions, a hydroxyl group at the 3 position, and a methoxy group at the 6 position. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents due to the presence of the hydroxyl group. The dichloro and methoxy substituents influence its chemical reactivity and polarity, making it a potential candidate for various applications in pharmaceuticals and agrochemicals. Additionally, the presence of multiple functional groups suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its biological activity and environmental behavior. As with many chlorinated compounds, it is important to consider its environmental impact and potential toxicity in various applications.
Formula:C8H6Cl2O4
InChI:InChI=1/C8H6Cl2O4/c1-14-7-3(9)2-4(11)6(10)5(7)8(12)13/h2,11H,1H3,(H,12,13)
SMILES:COc1c(cc(c(c1C(=O)O)Cl)O)Cl
Synonyms:- 3,6-Dichloro-5-hydroxy-o-anisic acid
- DICAMBA-5-HYDROXY
- 100ug/mlinAcetone:Water(90:10)
- 2,5-dichloro-3-hydroxy-6-methoxybenzoic acid
- o-Anisic acid, 3,6-dichloro-5-hydroxy-
- benzoicacid,2,5-dichloro-3-hydroxy-6-methoxy-
- Dicamba-5-hydroxy, 100 μg /μL in Acetonitrile
- 5-Hydroxydicamba
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dicamba-5-hydroxy 100 µg/mL in Acetonitrile
CAS:Formula:C8H6Cl2O4Color and Shape:Single SolutionMolecular weight:237.042,5-Dichloro-3-hydroxy-6-methoxybenzoic acid
CAS:2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid is an organic compound that can be used as a reagent for the detection of inorganic substances. This compound is sensitive to aliquots and can be used in immunochromatographic methods. 2,5-Dichloro-3-hydroxy-6-methoxybenzoic acid is also a pesticide analyte and has been validated for use in analytical methods. It can be used as a sensor for dichlorprop. Recoveries are typically greater than 90%.Formula:C8H6Cl2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:237.03 g/mol


