CAS 76005-64-6

2-(1-oxido-4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethyl decanoate

Description:

2-(1-oxido-4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethyl decanoate, with CAS number 76005-64-6, is a complex organic compound characterized by its unique structural features. It contains a piperazine moiety, which is a six-membered ring containing two nitrogen atoms, contributing to its potential biological activity. The presence of a trifluoromethyl group enhances its lipophilicity, which can influence its pharmacokinetic properties. The decanoate ester group suggests that it may have applications in drug delivery systems, as esters can improve solubility and absorption. Additionally, the phenothiazine structure is known for its use in antipsychotic medications, indicating potential therapeutic applications. The compound's oxido group may also play a role in its reactivity and stability. Overall, this substance exhibits characteristics that may be relevant in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological disorders. However, detailed studies would be necessary to fully understand its properties and potential applications.

Formula: C₃₂H₄₄F₃N₃O₃S

InChI: InChI=1/C32H44F3N3O3S/c1-2-3-4-5-6-7-8-14-31(39)41-24-23-38(40)21-19-36(20-22-38)17-11-18-37-27-12-9-10-13-29(27)42-30-16-15-26(25-28(30)37)32(33,34)35/h9-10,12-13,15-16,25H,2-8,11,14,17-24H2,1H3

SMILES: CCCCCCCCCC(=O)OCCN1(=O)CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1

Fluphenazine Decanoate N4-oxide

CAS: 76005-64-6

Compounds (excluding drugs) containing a phenothiazine ring-system (whether or not hydrogenated), not further fused

Formula: C₃₂H₄₄F₃N₃O₃S

Color and Shape: Off-White Powder

Molecular weight: 607.30555

Ref: 45-1280804

Fluphenazine Decanoate N-Oxide

CAS: 76005-64-6

Formula: C₃₂H₄₄F₃N₃O₃S

Color and Shape: Pale Yellow Solid

Molecular weight: 607.78

Ref: 4Z-F-119011

Fluphenazine Decanoate N4-Oxide

CAS: 76005-64-6

Applications Fluphenazine Decanoate N4-Oxide, is an impurity of Fluphenazine Decanoate (F598300), a psychotropic drug for treating schizophrenia-related disorders.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Frasch, K. et al.: Pharmacopay., 45, 138 (2012);  Aggarwal, N. et al.: J. Clin. Psychopharmacol., 32, 323 (2012)

Formula: C₃₂H₄₄F₃N₃O₃S

Color and Shape: Neat

Molecular weight: 607.77

Ref: TR-F598330

Fluphenazine Decanoate N-4-Oxide

CAS: 76005-64-6

Formula: C₃₂H₄₄F₃N₃O₃S

Molecular weight: 607.78

Ref: ST-EA-CP-F65010