
CAS 76005-98-6
:N-(2-Methoxy-4-methyl-3-pyridinyl)acetamide
Description:
N-(2-Methoxy-4-methyl-3-pyridinyl)acetamide, with the CAS number 76005-98-6, is a chemical compound characterized by its pyridine ring structure, which contributes to its aromatic properties. This compound features a methoxy group and a methyl group on the pyridine ring, enhancing its lipophilicity and potentially influencing its biological activity. The acetamide functional group indicates that it possesses both amine and carbonyl characteristics, which can participate in hydrogen bonding, affecting its solubility and reactivity. Typically, compounds like this may exhibit pharmacological properties, making them of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of the methoxy and methyl substituents may influence the compound's electronic properties and steric hindrance, impacting its overall behavior in chemical reactions and biological systems. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-6-4-5-10-9(13-3)8(6)11-7(2)12/h4-5H,1-3H3,(H,11,12)
InChI key:InChIKey=PNSGXOZEWPGLGX-UHFFFAOYSA-N
SMILES:N(C(C)=O)C1=C(OC)N=CC=C1C
Synonyms:- Acetamide, N-(2-methoxy-4-methyl-3-pyridinyl)-
- N-(2-Methoxy-4-methyl-3-pyridinyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.