CAS 76006-08-1

5-Chloro-1H-pyrazolo[3,4-c]pyridine

Description:

5-Chloro-1H-pyrazolo[3,4-c]pyridine is a heterocyclic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. This compound features a chlorine atom at the 5-position of the pyrazole ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the pyrazole and pyridine moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as these structures are often associated with various biological activities, including anti-inflammatory and anti-cancer properties. Additionally, the chlorine substituent can enhance lipophilicity and affect the compound's interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose specific health risks. Overall, 5-Chloro-1H-pyrazolo[3,4-c]pyridine is of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.

Formula: C₆H₄ClN₃

InChI: InChI=1/C6H4ClN3/c7-6-1-4-2-9-10-5(4)3-8-6/h1-3H,(H,9,10)

SMILES: c1c2cn[nH]c2cnc1Cl

Synonyms:

• 1H-pyrazolo[3,4-c]pyridine, 5-chloro-
• 5-Chloro-1H-pyrazolo[3,4-c]pyridine

5-Chloro-1H-pyrazolo[3,4-c]pyridine

CAS: 76006-08-1

Formula: C₆H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.5691

Ref: IN-DA0036KD

5-Chloro-1H-pyrazolo[3,4-c]pyridine

CAS: 76006-08-1

5-Chloro-1H-pyrazolo[3,4-c]pyridine

Purity: 99%

Color and Shape: Solid

Molecular weight: 153.57g/mol

Ref: 54-OR55452

5-Chloro-1H-pyrazolo[3,4-c]pyridine

CAS: 76006-08-1

Formula: C₆H₄ClN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 153.009

Ref: 10-F049270