CAS 760127-60-4

3-[4-(6-aminohexanoyloxy)phenyl]propanoic acid

Description:

3-[4-(6-aminohexanoyloxy)phenyl]propanoic acid, with the CAS number 760127-60-4, is an organic compound characterized by its structure, which includes a propanoic acid moiety linked to a phenyl group that is further substituted with a hexanoyloxy chain containing an amino group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the carboxylic acid and amino functional groups, which can also participate in hydrogen bonding. The amino group may impart basic characteristics, while the phenyl ring contributes to the compound's hydrophobic nature. The presence of the hexanoyloxy chain enhances its lipophilicity, potentially influencing its biological activity and interactions with cellular membranes. This compound may be of interest in pharmaceutical research, particularly in the development of drug delivery systems or as a building block in the synthesis of more complex molecules. Its specific reactivity and stability would depend on the surrounding conditions, such as pH and temperature.

Formula: C₁₅H₂₁NO₄

InChI: InChI=1/C15H21NO4/c16-11-3-1-2-4-15(19)20-13-8-5-12(6-9-13)7-10-14(17)18/h5-6,8-9H,1-4,7,10-11,16H2,(H,17,18)

3-(4-(6-Aminocaproyloxy)phenyl)propionic acid

CAS: 760127-60-4

Molecular weight: 279.33

Ref: 7W-GM9959