CAS 76013-31-5
:2-(4-oxido-4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethyl decanoate
Description:
2-(4-oxido-4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethyl decanoate, with CAS number 76013-31-5, is a complex organic compound characterized by its unique structural features. It contains a phenothiazine moiety, which is known for its applications in pharmaceuticals, particularly as antipsychotic agents. The presence of a trifluoromethyl group enhances its lipophilicity, potentially influencing its biological activity and pharmacokinetics. The piperazine ring contributes to its basicity and can participate in various interactions with biological targets. The decanoate ester group suggests that the compound may exhibit improved solubility and absorption characteristics, making it suitable for medicinal applications. Additionally, the oxido group indicates the presence of an oxygen atom that may play a role in the compound's reactivity and stability. Overall, this compound's intricate structure suggests potential utility in medicinal chemistry, particularly in the development of therapeutic agents targeting neurological disorders.
Formula:C32H44F3N3O3S
InChI:InChI=1/C32H44F3N3O3S/c1-2-3-4-5-6-7-8-14-31(39)41-24-20-36-18-22-38(40,23-19-36)21-11-17-37-27-12-9-10-13-29(27)42-30-16-15-26(25-28(30)37)32(33,34)35/h9-10,12-13,15-16,25H,2-8,11,14,17-24H2,1H3
SMILES:CCCCCCCCCC(=O)OCCN1CCN(=O)(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Fluphenazine Decanoate N1-Oxide
CAS:Controlled ProductFormula:C32H44F3N3O3SColor and Shape:NeatMolecular weight:607.77


