CymitQuimica logo

CAS 76014-10-3

:

4-Ethoxyphenylhydrazine hydrochloride

Description:
4-Ethoxyphenylhydrazine hydrochloride is a chemical compound characterized by its hydrazine functional group attached to a phenyl ring that is further substituted with an ethoxy group. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, which makes it useful in different chemical applications. It is primarily utilized in organic synthesis, particularly in the preparation of azo compounds and as a reagent in various chemical reactions. The presence of the hydrazine group imparts specific reactivity, allowing it to participate in condensation reactions and serve as a precursor for more complex molecules. As with many hydrazine derivatives, it is important to handle this compound with care due to potential toxicity and reactivity. Safety data sheets should be consulted for proper handling and disposal procedures. Overall, 4-Ethoxyphenylhydrazine hydrochloride is a valuable compound in synthetic organic chemistry, contributing to the development of various chemical products.
Formula:C8H13ClN2O
InChI:InChI=1S/C8H12N2O.ClH/c1-2-11-8-5-3-7(10-9)4-6-8;/h3-6,10H,2,9H2,1H3;1H
InChI key:RROBGBQPYPYDFT-UHFFFAOYSA-N
SMILES:CCOC1=CC=C(C=C1)NN.Cl
Found 4 products.