CAS 760192-85-6
:(4-bromo-3-fluoro-phenyl)-(4-methoxyphenyl)methanone
Description:
(4-bromo-3-fluoro-phenyl)-(4-methoxyphenyl)methanone, with the CAS number 760192-85-6, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the methanone moiety, which is attached to two distinct phenyl rings. One of these rings is substituted with a bromine atom and a fluorine atom, while the other carries a methoxy group. This substitution pattern contributes to its unique electronic properties and potential reactivity. The presence of halogens (bromine and fluorine) typically enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy group can also affect the compound's solubility and stability. Overall, this compound may exhibit interesting properties that could be explored in various applications, including pharmaceuticals and agrochemicals, due to its structural features and functional groups.
Formula:C14H10BrFO2
InChI:InChI=1/C14H10BrFO2/c1-18-11-5-2-9(3-6-11)14(17)10-4-7-12(15)13(16)8-10/h2-8H,1H3
SMILES:COc1ccc(cc1)C(=O)c1ccc(c(c1)F)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.