CAS 760192-87-8
:(3-chloro-4-fluoro-phenyl)-(4-methoxyphenyl)methanone
Description:
(3-chloro-4-fluoro-phenyl)-(4-methoxyphenyl)methanone, with the CAS number 760192-87-8, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the "methanone" suffix, which is attached to a phenyl ring that is further substituted with both a chloro and a fluoro group, enhancing its reactivity and potential biological activity. The presence of a methoxy group on another phenyl ring contributes to its electronic properties, potentially influencing its solubility and interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Additionally, the presence of halogen substituents can affect the compound's lipophilicity and metabolic stability, which are critical factors in pharmacokinetics. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in organic chemistry.
Formula:C14H10ClFO2
InChI:InChI=1/C14H10ClFO2/c1-18-11-5-2-9(3-6-11)14(17)10-4-7-13(16)12(15)8-10/h2-8H,1H3
SMILES:COc1ccc(cc1)C(=O)c1ccc(c(c1)Cl)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.