CAS 760192-88-9
:(4-Bromophenyl)-2-naphthalenylmethanone
Description:
(4-Bromophenyl)-2-naphthalenylmethanone, with the CAS number 760192-88-9, is an organic compound characterized by its complex structure, which includes a naphthalene moiety and a bromophenyl group. This compound typically exhibits a solid state at room temperature and is likely to be insoluble or poorly soluble in water, while being more soluble in organic solvents such as dichloromethane or ethanol. The presence of the bromine atom introduces notable electronic effects, potentially enhancing its reactivity and influencing its physical properties, such as melting point and boiling point. The ketone functional group contributes to its chemical reactivity, allowing for various reactions such as nucleophilic addition or condensation. Additionally, the compound may exhibit interesting optical properties, making it a candidate for applications in organic electronics or as a fluorescent probe. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and disposal procedures should be followed.
Formula:C17H11BrO
InChI:InChI=1/C17H11BrO/c18-16-9-7-13(8-10-16)17(19)15-6-5-12-3-1-2-4-14(12)11-15/h1-11H
InChI key:InChIKey=RPYONPWJLGOFGD-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC2=C(C=C1)C=CC=C2)C3=CC=C(Br)C=C3
Synonyms:- (4-Bromophenyl)-2-naphthalenylmethanone
- Methanone, (4-bromophenyl)-2-naphthalenyl-
- 4-BROMOPHENYL-2'-NAPHTHYL KETONE
- (4-Bromophenyl)(naphthalen-2-yl)methanone
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery