CAS 760192-99-2
:(2-Chloro-3-pyridinyl)(3-methyl-2-thienyl)methanone
Description:
(2-Chloro-3-pyridinyl)(3-methyl-2-thienyl)methanone is a chemical compound characterized by its unique structure, which includes a pyridine ring and a thienyl group. The presence of a chlorine atom at the 2-position of the pyridine ring contributes to its reactivity and potential biological activity. The methanone functional group indicates that the compound contains a carbonyl group (C=O) bonded to a carbon atom that is also connected to the two aromatic rings. This compound may exhibit properties typical of both heterocyclic compounds and ketones, such as potential pharmacological activity, making it of interest in medicinal chemistry. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the presence of sulfur in the thienyl group may influence its electronic properties and solubility. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of organic synthesis and drug development.
Formula:C11H8ClNOS
InChI:InChI=1/C11H8ClNOS/c1-7-4-6-15-10(7)9(14)8-3-2-5-13-11(8)12/h2-6H,1H3
InChI key:InChIKey=NJINBRWBUJJELI-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C=CS1)C2=C(Cl)N=CC=C2
Synonyms:- (2-Chloro-3-pyridinyl)(3-methyl-2-thienyl)methanone
- (2-Chloropyridin-3-Yl)(3-Methyl-2-Thienyl)Methanone
- (2-Chloropyridin-3-yl)-(3-methylthiophen-2-yl)methanone
- 2-Chloro-3-(3-methyl-2-thenoyl)pyridine
- 2-Chloro-3-(3-methylthiophene-2-carbonyl)pyridine
- Methanone, (2-Chloro-3-Pyridinyl)(3-Methyl-2-Thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.