CAS 760193-01-9

3-[2-(2-chloro-3-pyridyl)-2-oxo-ethyl]benzonitrile

Description:

3-[2-(2-chloro-3-pyridyl)-2-oxo-ethyl]benzonitrile, identified by its CAS number 760193-01-9, is a chemical compound that features a complex structure comprising a benzonitrile moiety and a pyridine derivative. This compound typically exhibits characteristics common to nitriles, such as a high boiling point and moderate solubility in organic solvents. The presence of the chloro and keto functional groups contributes to its reactivity and potential biological activity. It may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, due to the electrophilic nature of the carbonyl group and the presence of the nitrile group. Additionally, the pyridine ring can influence the compound's electronic properties and its interaction with biological targets, making it of interest in medicinal chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₄H₉ClN₂O

InChI: InChI=1/C14H9ClN2O/c15-14-12(5-2-6-17-14)13(18)8-10-3-1-4-11(7-10)9-16/h1-7H,8H2

SMILES: c1cc(cc(c1)C#N)CC(=O)c1cccnc1Cl

Synonyms:

• 3-[2-(2-Chloropyridin-3-Yl)-2-Oxoethyl]Benzonitrile
• Benzonitrile, 3-[2-(2-Chloro-3-Pyridinyl)-2-Oxoethyl]-