CAS 760207-87-2
:5-Bromo-2-methoxy-3-methylpyridine
Description:
5-Bromo-2-methoxy-3-methylpyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position, a methoxy group (-OCH3) at the 2-position, and a methyl group (-CH3) at the 3-position contributes to its unique chemical properties. This compound is typically a colorless to light yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents such as ethanol and dichloromethane but may have limited solubility in water due to its hydrophobic characteristics. The bromine substituent can enhance its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the methoxy and methyl groups can influence its electronic properties and steric hindrance, affecting its behavior in biological systems and synthetic applications. Overall, 5-Bromo-2-methoxy-3-methylpyridine is of interest in medicinal chemistry and material science for its potential applications.
Formula:C7H8BrNO
InChI:InChI=1/C7H8BrNO/c1-5-3-6(8)4-9-7(5)10-2/h3-4H,1-2H3
SMILES:Cc1cc(cnc1OC)Br
Synonyms:- Pyridine, 5-Bromo-2-Methoxy-3-Methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Bromo-2-methoxy-3-methylpyridine, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H8BrNOPurity:97%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:202.055-Bromo-2-methoxy-3-methylpyridine
CAS:Formula:C7H8BrNOPurity:97%Color and Shape:LiquidMolecular weight:202.04855-Bromo-2-methoxy-3-methylpyridine
CAS:5-Bromo-2-methoxy-3-methylpyridinePurity:98%Molecular weight:202.05g/mol5-Bromo-2-methoxy-3-methylpyridine
CAS:Formula:C7H8BrNOPurity:97%Color and Shape:LiquidMolecular weight:202.051



