CymitQuimica logo

CAS 760211-54-9

:

2-(3,4-difluorobenzyl)-1,3-dioxolane

Description:
2-(3,4-Difluorobenzyl)-1,3-dioxolane is an organic compound characterized by its unique structure, which includes a dioxolane ring and a difluorobenzyl substituent. The presence of the dioxolane moiety contributes to its potential as a solvent or intermediate in organic synthesis, while the difluorobenzyl group may impart specific electronic and steric properties that can influence reactivity and interactions with biological targets. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure suggests it may exhibit moderate polarity, making it soluble in various organic solvents. The difluorobenzyl group can enhance lipophilicity, potentially affecting its bioavailability and interaction with biological systems. As with many fluorinated compounds, it may exhibit unique chemical stability and reactivity patterns. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks. Overall, 2-(3,4-difluorobenzyl)-1,3-dioxolane is of interest in both synthetic chemistry and potential pharmaceutical applications.
Formula:C10H10F2O2
InChI:InChI=1/C10H10F2O2/c11-8-2-1-7(5-9(8)12)6-10-13-3-4-14-10/h1-2,5,10H,3-4,6H2
SMILES:c1cc(c(cc1CC1OCCO1)F)F
Synonyms:
  • 1,3-Dioxolane, 2-[(3,4-difluorophenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.