
CAS 76029-67-9
:2-(2,2,2-Trifluoroethoxy)-1H-isoindole-1,3(2H)-dione
Description:
2-(2,2,2-Trifluoroethoxy)-1H-isoindole-1,3(2H)-dione, with the CAS number 76029-67-9, is a chemical compound characterized by its unique structure that includes an isoindole core and a trifluoroethoxy substituent. This compound typically exhibits properties associated with both the isoindole and trifluoroalkyl groups, such as increased lipophilicity and potential biological activity. The presence of the trifluoroethoxy group can enhance the compound's stability and influence its reactivity, making it of interest in various chemical and pharmaceutical applications. Isoindole derivatives are often studied for their potential in medicinal chemistry due to their diverse biological activities, including anti-inflammatory and anticancer properties. The trifluoromethyl group is known for imparting unique electronic properties, which can affect the compound's interaction with biological targets. Overall, this compound's characteristics make it a subject of interest in research focused on developing new therapeutic agents or materials with specific functional properties.
Formula:C10H6F3NO3
InChI:InChI=1S/C10H6F3NO3/c11-10(12,13)5-17-14-8(15)6-3-1-2-4-7(6)9(14)16/h1-4H,5H2
InChI key:InChIKey=KAHYXMVUTQNSKN-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1OCC(F)(F)F)=CC=CC2
Synonyms:- 2-(2,2,2-Trifluoroethoxy)isoindoline-1,3-dione
- 1H-Isoindole-1,3(2H)-dione, 2-(2,2,2-trifluoroethoxy)-
- 2-(2,2,2-Trifluoroethoxy)-1H-isoindole-1,3(2H)-dione
- 2-(2,2,2-Trifluoroethoxy)-2,3-dihydro-1H-isoindole-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.