
CAS 7603-37-4
:2,3,4,7-Tetrahydro-1H-indene
Description:
2,3,4,7-Tetrahydro-1H-indene, with the CAS number 7603-37-4, is a bicyclic organic compound characterized by its unique structure, which consists of a fused cyclopentane and cyclohexene ring system. This compound is typically a colorless to pale yellow liquid at room temperature and possesses a distinctive aromatic odor. It is known for its relatively low boiling point and moderate solubility in organic solvents, making it useful in various chemical applications. The compound exhibits reactivity typical of alkenes, allowing it to participate in addition reactions and polymerization processes. Additionally, 2,3,4,7-tetrahydro-1H-indene can serve as an intermediate in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, its unique structural features and reactivity make it a compound of interest in organic chemistry and industrial applications.
Formula:C9H12
InChI:InChI=1S/C9H12/c1-2-5-9-7-3-6-8(9)4-1/h1-2H,3-7H2
InChI key:InChIKey=PJEOOBRBALZZSL-UHFFFAOYSA-N
SMILES:C12=C(CCC1)CC=CC2
Synonyms:- 2,3,4,7-Tetrahydro-1H-indene
- 4,7-Dihydroindan
- Bicyclo[4.3.0]nona-1(6),3-diene
- Indan, 4,7-dihydro-
- 1H-Indene, 2,3,4,7-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
