CymitQuimica logo

CAS 76041-86-6

:

2-bromo-N,N-diethylbenzamide

Description:
2-Bromo-N,N-diethylbenzamide is an organic compound characterized by its structure, which includes a benzamide core substituted with a bromine atom at the ortho position relative to the amide group and two ethyl groups attached to the nitrogen atom. This compound typically appears as a white to off-white solid and is soluble in organic solvents. Its molecular formula reflects the presence of carbon, hydrogen, nitrogen, and bromine, contributing to its unique chemical properties. The presence of the bromine atom introduces notable reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The diethyl substituents enhance its lipophilicity, potentially influencing its biological activity and interactions. As with many brominated compounds, it may exhibit specific environmental and health considerations, necessitating careful handling and disposal. Overall, 2-bromo-N,N-diethylbenzamide serves as an interesting subject for research due to its structural features and potential applications in various chemical fields.
Formula:C11H14BrNO
InChI:InChI=1/C11H14BrNO/c1-3-13(4-2)11(14)9-7-5-6-8-10(9)12/h5-8H,3-4H2,1-2H3
InChI key:BYMBWCOGISFGJL-UHFFFAOYSA-N
SMILES:CCN(CC)C(=O)c1ccccc1Br
Synonyms:
  • benzamide, 2-bromo-N,N-diethyl-
Found 5 products.