CymitQuimica logo

CAS 76041-87-7

:

N,N-Diethyl-2-iodobenzamide

Description:
N,N-Diethyl-2-iodobenzamide is an organic compound characterized by its structure, which includes a benzamide core substituted with an iodine atom and two ethyl groups attached to the nitrogen atom. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its moderate solubility in organic solvents. The presence of the iodine atom contributes to its reactivity, making it useful in various chemical synthesis applications, particularly in the field of medicinal chemistry and organic synthesis. The diethyl substituents enhance its lipophilicity, which can influence its biological activity and interaction with cellular targets. Additionally, N,N-Diethyl-2-iodobenzamide may exhibit specific pharmacological properties, although detailed studies would be necessary to fully understand its biological implications. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled. Proper storage and disposal methods are also essential to mitigate environmental impact.
Formula:C11H14INO
InChI:InChI=1S/C11H14INO/c1-3-13(4-2)11(14)9-7-5-6-8-10(9)12/h5-8H,3-4H2,1-2H3
InChI key:InChIKey=BYACPVJFVPBGQI-UHFFFAOYSA-N
SMILES:C(N(CC)CC)(=O)C1=C(I)C=CC=C1
Synonyms:
  • N,N-Diethyl-2-iodobenzamide
  • 2-Iodo-N,N-diethylbenzamide
  • Benzamide, N,N-diethyl-2-iodo-
Found 3 products.