CAS 76044-37-6

5-Chloro-2-methyl[1,2,4]triazolo[1,5-c]pyrimidine

Description:

5-Chloro-2-methyl[1,2,4]triazolo[1,5-c]pyrimidine is a heterocyclic compound characterized by its unique triazole and pyrimidine ring structures. This compound features a chlorine atom and a methyl group, which contribute to its chemical reactivity and potential biological activity. It is typically a crystalline solid, exhibiting moderate solubility in polar solvents. The presence of the triazole moiety often imparts interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The compound may exhibit various biological activities, including antimicrobial or antifungal properties, depending on its specific structure and substituents. Its synthesis usually involves multi-step organic reactions, and it can be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography. As with many heterocycles, the electronic properties of 5-Chloro-2-methyl[1,2,4]triazolo[1,5-c]pyrimidine can be influenced by the substituents on the rings, affecting its reactivity and interactions with biological targets. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₆H₅ClN₄

InChI: InChI=1S/C6H5ClN4/c1-4-9-5-2-3-8-6(7)11(5)10-4/h2-3H,1H3

InChI key: InChIKey=CCSKHIYVLRCCNX-UHFFFAOYSA-N

SMILES: ClC=1N2C(=NC(C)=N2)C=CN1

Synonyms:

• 5-Chloro-2-methyl[1,2,4]triazolo[1,5-c]pyrimidine
• [1,2,4]Triazolo[1,5-c]pyrimidine, 5-chloro-2-methyl-