CAS 76045-49-3
:4-[3-[4-Hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]propyl]-1,3-benzenediol
Description:
4-[3-[4-Hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]propyl]-1,3-benzenediol, also known by its CAS number 76045-49-3, is an organic compound characterized by its complex structure featuring multiple aromatic rings and hydroxyl groups. This compound is a derivative of phenolic compounds, which are known for their antioxidant properties. The presence of the 3-methyl-2-buten-1-yl group contributes to its potential biological activity, possibly enhancing its interaction with biological systems. The hydroxyl groups in the structure are significant for solubility and reactivity, allowing for hydrogen bonding and influencing the compound's overall polarity. This compound may exhibit various pharmacological effects, including anti-inflammatory and antioxidant activities, making it of interest in medicinal chemistry and natural product research. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C20H24O3
InChI:InChI=1S/C20H24O3/c1-14(2)6-8-17-12-15(7-11-19(17)22)4-3-5-16-9-10-18(21)13-20(16)23/h6-7,9-13,21-23H,3-5,8H2,1-2H3
InChI key:InChIKey=CMOZGCJOTGLPKO-UHFFFAOYSA-N
SMILES:C(C=C(C)C)C1=CC(CCCC2=C(O)C=C(O)C=C2)=CC=C1O
Synonyms:- Broussonin C
- 1,3-Benzenediol, 4-[3-[4-hydroxy-3-(3-methyl-2-butenyl)phenyl]propyl]-
- 1,3-Benzenediol, 4-[3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]propyl]-
- 4-[3-[4-Hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]propyl]-1,3-benzenediol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Broussonin C
CAS:Broussonin C and broussin are antifungal compounds. Broussonin C exerts simple reversible slow-binding inhibition against diphenolase.Formula:C20H24O3Purity:98%Color and Shape:SolidMolecular weight:312.4Broussonin C
CAS:Broussonin C is a bioactive compound, which is a natural lignan. It is sourced from the Broussonetia genus, particularly known for its presence in the mulberry family, Moraceae. Broussonin C functions primarily by modulating specific biochemical pathways that influence cancer cell proliferation. It exerts its effects through the inhibition of key signaling pathways, such as the MAPK and PI3K/Akt pathways, which are crucial for cell growth and survival. Additionally, Broussonin C may induce apoptosis in malignant cells, highlighting its potential as a therapeutic agent.
Formula:C20H24O3Purity:Min. 95%Molecular weight:312.4 g/mol



