CAS 7605-15-4
:9H-thioxanthen-9-one 10-oxide
Description:
9H-thioxanthen-9-one 10-oxide, with the CAS number 7605-15-4, is an organic compound that belongs to the class of thioxanthones. It is characterized by a fused ring structure that includes a thioxanthene core, which is a polycyclic aromatic compound. This substance typically appears as a yellow to orange solid and is known for its photochemical properties, particularly its ability to undergo photochemical reactions upon exposure to light. It is often utilized in various applications, including as a photoinitiator in polymerization processes and in the production of dyes and pigments. The compound exhibits moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. Additionally, 9H-thioxanthen-9-one 10-oxide can participate in redox reactions, making it of interest in studies related to electron transfer processes. Safety data indicates that, like many organic compounds, it should be handled with care to avoid potential health hazards.
Formula:C13H8O2S
InChI:InChI=1/C13H8O2S/c14-13-9-5-1-3-7-11(9)16(15)12-8-4-2-6-10(12)13/h1-8H
Synonyms:- 9H-Thioxanthen-9-one, 10-oxide
- Thioxanthen-9-one, 10-oxide
- 10H-Dibenzo[b,e]thiopyran-10-one 5-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
