CAS 7605-28-9
:(Phenylsulfonyl)acetonitrile
Description:
(Phenylsulfonyl)acetonitrile, with the CAS number 7605-28-9, is an organic compound characterized by the presence of both a nitrile group and a sulfonyl group attached to a phenyl ring. This compound typically appears as a colorless to pale yellow solid and is known for its moderate solubility in polar organic solvents. Its molecular structure features a phenyl group linked to a sulfonyl moiety, which enhances its reactivity and makes it useful in various chemical syntheses, particularly in the field of pharmaceuticals and agrochemicals. The nitrile functional group contributes to its ability to participate in nucleophilic reactions, while the sulfonyl group can act as a leaving group in certain reactions. Additionally, (Phenylsulfonyl)acetonitrile may exhibit properties such as stability under standard conditions, but it should be handled with care due to potential toxicity and irritant effects. Overall, this compound serves as a valuable intermediate in organic synthesis, facilitating the development of more complex chemical entities.
Formula:C8H7NO2S
InChI:InChI=1S/C8H7NO2S/c9-6-7-12(10,11)8-4-2-1-3-5-8/h1-5H,7H2
InChI key:InChIKey=ZFCFFNGBCVAUDE-UHFFFAOYSA-N
SMILES:S(CC#N)(=O)(=O)C1=CC=CC=C1
Synonyms:- (Benzenesulfonyl)acetonitrile
- (Phenylsulfonyl)Acetonitrile
- 2-(Benzenesulfonyl)acetonitrile
- 2-(Phenylsulfonyl)acetonitrile
- Acetonitrile, (phenylsulfonyl)-
- Acetonitrile, 2-(phenylsulfonyl)-
- Ai3-16855
- Cyano(phenylsulfonyl)methane
- Cyanomethyl phenyl sulfone
- NSC 51007
- Phenylsulphonylacetonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Phenylsulfonylacetonitrile
CAS:Formula:C8H7NO2SPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:181.212-(PHENYLSULFONYL)ACETONITRILE
CAS:Formula:C8H7NO2SPurity:98%Color and Shape:SolidMolecular weight:181.2117Ref: IN-DA003TQ8
1gTo inquire5g20.00€10g25.00€15g44.00€25g40.00€100g98.00€200g177.00€300g189.00€400g248.00€(Phenylsulfonyl)acetonitrile
CAS:Formula:C8H7NO2SPurity:98%Color and Shape:SolidMolecular weight:181.21(Phenylsulphonyl)acetonitrile
CAS:(Phenylsulphonyl)acetonitrilePurity:98%Color and Shape:Off-White To Beige SolidMolecular weight:181.21g/molBenzenesulphonylacetonitrile
CAS:Benzenesulphonylacetonitrile is an alkanoic acid nucleophile with a benzimidazole derivative. It has shown potential for use as a cancer drug by inhibiting tumor-associated enzymes and inducing apoptosis in cancer cells. Benzenesulphonylacetonitrile is also active against inflammatory diseases such as rheumatoid arthritis, psoriatic arthritis, and Crohn's disease. This drug can be synthesized by the reaction of sodium salts with benzenesulphonylacetone followed by a nucleophilic substitution reaction with methylene chloride. The synthesis of benzenesulphonylacetonitrile requires anhydrous acetonitrile and palladium-catalyzed coupling reactions in the presence of sodium carbonate. Benzenesulphonylacetonitrile has chemical stability in the presence of acids, bases, and heat.br>Formula:C8H7NO2SPurity:Min. 95%Color and Shape:PowderMolecular weight:181.21 g/mol





