CAS 7605-65-4
:cyclopropane-1,1,2,2-tetracarboxylic acid
Description:
Cyclopropane-1,1,2,2-tetracarboxylic acid, also known as tetracarboxylic acid, is a cyclic organic compound characterized by its four carboxylic acid functional groups attached to a cyclopropane ring. This compound is notable for its high reactivity due to the strain in the three-membered cyclopropane ring, which can lead to unique chemical behavior. The presence of multiple carboxylic acid groups contributes to its strong acidity and potential for forming various salts and esters. It is typically a colorless solid at room temperature and is soluble in polar solvents due to the hydrophilic nature of the carboxylic acid groups. Cyclopropane-1,1,2,2-tetracarboxylic acid can be used in organic synthesis and may serve as a building block for more complex molecules. Its derivatives may exhibit interesting biological activities, making it of interest in medicinal chemistry. However, handling should be done with care due to the potential for reactivity and the need for proper safety protocols in laboratory settings.
Formula:C7H6O8
InChI:InChI=1/C7H6O8/c8-2(9)6(3(10)11)1-7(6,4(12)13)5(14)15/h1H2,(H,8,9)(H,10,11)(H,12,13)(H,14,15)
SMILES:C1C(C(=O)O)(C(=O)O)C1(C(=O)O)C(=O)O
Synonyms:- 1,1,2,2-Cyclopropanetetracarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
