CymitQuimica logo

CAS 76052-76-1

:

Quinoxaline, 2-chloro-5-methoxy-

Description:
Quinoxaline, 2-chloro-5-methoxy- is an organic compound characterized by its bicyclic structure, which consists of a fused benzene and pyrazine ring. The presence of a chlorine atom at the 2-position and a methoxy group at the 5-position contributes to its unique chemical properties. This compound typically exhibits moderate polarity due to the electronegative chlorine and oxygen atoms, influencing its solubility in various organic solvents. Quinoxaline derivatives are known for their biological activity, including potential applications in pharmaceuticals, particularly as antimicrobial and anticancer agents. The compound may also participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions, due to the reactivity of the halogen and the methoxy group. Its molecular structure allows for interactions with biological targets, making it a subject of interest in medicinal chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C9H7ClN2O
InChI:InChI=1S/C9H7ClN2O/c1-13-7-4-2-3-6-9(7)11-5-8(10)12-6/h2-5H,1H3
InChI key:JRHWLTKUSQJBHH-UHFFFAOYSA-N
SMILES:COC1=CC=CC2=NC(=CN=C21)Cl
Found 4 products.