CAS 7606-33-9

Phenol, 4-(3-azetidinyl)-, hydrochloride (1:1)

Description:

Phenol, 4-(3-azetidinyl)-, hydrochloride (1:1), with the CAS number 7606-33-9, is a chemical compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of the azetidine moiety indicates that it contains a four-membered nitrogen-containing ring, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit antimicrobial or analgesic properties, making it of interest in medicinal chemistry. Its stability, reactivity, and interaction with biological systems can be influenced by the functional groups present, and it may undergo various chemical reactions typical of phenolic compounds, such as electrophilic substitution or oxidation. Safety data should be consulted for handling and usage, as phenolic compounds can be toxic and require appropriate precautions.

Formula: C₉H₁₁NO·ClH

InChI: InChI=1S/C9H11NO.ClH/c11-9-3-1-7(2-4-9)8-5-10-6-8;/h1-4,8,10-11H,5-6H2;1H

InChI key: InChIKey=WSXWTJFNXAXLPM-UHFFFAOYSA-N

SMILES: OC1=CC=C(C2CNC2)C=C1.Cl

Synonyms:

• Phenol, 4-(3-azetidinyl)-, hydrochloride (1:1)
• Phenol, p-3-azetidinyl-, hydrochloride

4-(Azetidin-3-yl)phenol hydrochloride

CAS: 7606-33-9

Versatile small molecule scaffold

Formula: C₉H₁₂ClNO

Purity: Min. 95%

Molecular weight: 185.7 g/mol

Ref: 3D-HAA60633