
CAS 7606-36-2
:Azetidine, 3-(4-methylphenyl)-, hydrochloride (1:1)
Description:
Azetidine, 3-(4-methylphenyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of the 4-methylphenyl group indicates that there is a para-substituted methyl group on a phenyl ring attached to the azetidine. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of more complex molecules. Its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and the presence of other substances. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H13N·ClH
InChI:InChI=1S/C10H13N.ClH/c1-8-2-4-9(5-3-8)10-6-11-7-10;/h2-5,10-11H,6-7H2,1H3;1H
InChI key:InChIKey=BAHSOYSZQWRWHZ-UHFFFAOYSA-N
SMILES:CC1=CC=C(C2CNC2)C=C1.Cl
Synonyms:- Azetidine, 3-p-tolyl-, hydrochloride
- Azetidine, 3-(4-methylphenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.