CAS 76066-33-6

Tricyclo[3.3.1.13,7]decane-1-methanol, α-(aminomethyl)-, hydrochloride (1:1)

Description:

Tricyclo[3.3.1.1^3,7]decane-1-methanol, α-(aminomethyl)-, hydrochloride (1:1), with the CAS number 76066-33-6, is a chemical compound characterized by its unique tricyclic structure, which consists of three interconnected cycloalkane rings. This compound features a hydroxymethyl group and an amino group, contributing to its potential as a functionalized amine. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amino group suggests potential biological activity, possibly as a precursor or intermediate in the synthesis of more complex molecules. Its structural complexity may influence its reactivity and interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the hydrochloride salt, which can be corrosive. Overall, this compound's unique structure and functional groups make it of interest in both synthetic organic chemistry and medicinal chemistry.

Formula: C₁₂H₂₁NO·ClH

InChI: InChI=1S/C12H21NO.ClH/c13-7-11(14)12-4-8-1-9(5-12)3-10(2-8)6-12;/h8-11,14H,1-7,13H2;1H

InChI key: InChIKey=RVHFFZFYWDHUMU-UHFFFAOYSA-N

SMILES: C(CN)(O)C12CC3CC(C1)CC(C2)C3.Cl

Synonyms:

• Tricyclo[3.3.1.13,7]decane-1-methanol, α-(aminomethyl)-, hydrochloride
• Tricyclo[3.3.1.13,7]decane-1-methanol, α-(aminomethyl)-, hydrochloride (1:1)