
CAS 76067-50-0
:1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, polymer with 1,3,5-triazine-2,4,6-triamine
Description:
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, polymer with 1,3,5-triazine-2,4,6-triamine, is a synthetic polymer characterized by its unique structure derived from triazine rings. This compound features a combination of triazine and trione functionalities, contributing to its stability and potential applications in various fields. It exhibits high thermal stability and resistance to degradation, making it suitable for use in high-performance materials. The polymer's properties are influenced by its nitrogen-rich triazine backbone, which can enhance its reactivity and interaction with other chemical species. Additionally, it may demonstrate interesting optical and electronic properties, making it a candidate for applications in coatings, adhesives, and possibly in the field of electronics. The polymer's solubility and processability can vary depending on its molecular weight and the specific conditions under which it is synthesized. Overall, this compound represents a versatile material with potential applications in advanced materials science and engineering.
Formula:(C3H6N6·C3H3N3O3)x
InChI:InChI=1S/C3H6N6.C3H3N3O3/c4-1-7-2(5)9-3(6)8-1;7-1-4-2(8)6-3(9)5-1/h(H6,4,5,6,7,8,9);(H3,4,5,6,7,8,9)
InChI key:InChIKey=ZQKXQUJXLSSJCH-UHFFFAOYSA-N
SMILES:O=C1NC(=O)NC(=O)N1.NC=1N=C(N)N=C(N)N1
Synonyms:- 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, polymer with 1,3,5-triazine-2,4,6-triamine
- Melamine-cyanuric acid copolymer
- 1,3,5-Triazine-2,4,6-triamine, polymer with 1,3,5-triazine-2,4,6(1H,3H,5H)-trione
- Cyanuric acid-melamine copolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1,3,5-Triazine-2,4,6(1H,3H,5H)-trione, polymer with 1,3,5-triazine-2,4,6-triamine
CAS:Formula:C6H9N9O3Molecular weight:255.1942
